(3-Cyanophenyl)acetic acid
Catalog No: FT-0690381
CAS No: 1878-71-3
- Chemical Name: (3-Cyanophenyl)acetic acid
- Molecular Formula: C9H7NO2
- Molecular Weight: 161.16
- InChI Key: ZNXMNKGBHYVNNE-UHFFFAOYSA-N
- InChI: InChI=1S/C9H7NO2/c10-6-8-3-1-2-7(4-8)5-9(11)12/h1-4H,5H2,(H,11,12)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 161.15700 |
| Density: | 1.26g/cm3 |
| CAS: | 1878-71-3 |
| Bolling_Point: | 342.1ºC at 760mmHg |
| Product_Name: | 2-(3-cyanophenyl)acetic acid |
| Melting_Point: | 113-117ºC(lit.) |
| Flash_Point: | 160.7ºC |
| MF: | C9H7NO2 |
| Density: | 1.26g/cm3 |
|---|---|
| LogP: | 1.18538 |
| Flash_Point: | 160.7ºC |
| Melting_Point: | 113-117ºC(lit.) |
| FW: | 161.15700 |
| PSA: | 61.09000 |
| Exact_Mass: | 161.04800 |
| MF: | C9H7NO2 |
| Bolling_Point: | 342.1ºC at 760mmHg |
| Vapor_Pressure: | 2.97E-05mmHg at 25°C |
| Refractive_Index: | 1.576 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
|---|---|
| Hazard_Codes: | Xn: Harmful; |
| Risk_Statements(EU): | R22 |
| Safety_Statements: | S36/37 |
| Symbol: | Warning |
| Warning_Statement: | P280 |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2926909090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)